For research use only. Not for therapeutic Use.
1-Ethylisoquinoline(Cat No.:L043985)is a valuable compound in pharmaceutical research and organic synthesis, featuring an ethyl group attached to an isoquinoline ring. This aromatic heterocycle serves as a key intermediate in the development of various bioactive molecules, including potential therapeutic agents. Its structure allows for diverse chemical modifications, making it essential in the synthesis of complex alkaloids and other nitrogen-containing compounds. High purity and stability ensure consistent performance, supporting advanced research in medicinal chemistry, drug discovery, and the development of innovative chemical entities.
CAS Number | 7661-60-1 |
Molecular Formula | C11H11N |
Purity | ≥95% |
IUPAC Name | 1-ethylisoquinoline |
InChI | InChI=1S/C11H11N/c1-2-11-10-6-4-3-5-9(10)7-8-12-11/h3-8H,2H2,1H3 |
InChIKey | UBDYMAZEEMMDCG-UHFFFAOYSA-N |
SMILES | CCC1=NC=CC2=CC=CC=C21 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |