For research use only. Not for therapeutic Use.
(1-Ethylpiperidin-4-YL)methanol is an organic compound featuring a piperidine ring substituted with an ethyl group and a hydroxymethyl group. This structure enhances its potential as a versatile intermediate in organic synthesis and pharmaceutical chemistry. It may serve as a building block for the development of various bioactive compounds, including potential analgesics and psychoactive agents. Its unique functional groups facilitate further chemical modifications, making it a valuable candidate for research in drug development and medicinal applications.
| Catalog Number | R072836 |
| CAS Number | 90226-87-2 |
| Molecular Formula | C8H17NO |
| Purity | ≥95% |
| IUPAC Name | (1-ethylpiperidin-4-yl)methanol |
| InChI | InChI=1S/C8H17NO/c1-2-9-5-3-8(7-10)4-6-9/h8,10H,2-7H2,1H3 |
| InChIKey | FLOQYJOORROJQU-UHFFFAOYSA-N |
| SMILES | CCN1CCC(CC1)CO |
