For research use only. Not for therapeutic Use.
1-Ethynyl-2,4,5-trifluorobenzene(Cat No.:L007188), is a chemical compound with the molecular formula C8H3F3. It features a benzene ring substituted with ethynyl (-C≡CH) and trifluoromethyl (-CF3) groups at the 1st and 2nd positions and a hydrogen atom at the 3rd position. This compound is significant in organic synthesis, particularly in the preparation of functionalized benzene derivatives for various applications. Its unique structure and reactivity offer opportunities for creating diverse organic molecules, contributing to research in organic chemistry, materials science, and pharmaceutical development. Researchers utilize it as a key building block for the synthesis of specialized compounds, driving innovation in multiple scientific fields.
CAS Number | 1097874-78-6 |
Molecular Formula | C8H3F3 |
Purity | ≥95% |
IUPAC Name | 1-ethynyl-2,4,5-trifluorobenzene |
InChI | InChI=1S/C8H3F3/c1-2-5-3-7(10)8(11)4-6(5)9/h1,3-4H |
InChIKey | GFSHMVIJBUJEKV-UHFFFAOYSA-N |
SMILES | C#CC1=CC(=C(C=C1F)F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |