For research use only. Not for therapeutic Use.
1-Ethynyl Pyrene(CAT: I020766) is an organic compound characterized by the presence of an ethynyl functional group attached to the pyrene aromatic framework. This molecule is commonly used in material science and organic electronics research due to its photophysical properties, including strong fluorescence and high thermal stability. 1-Ethynyl Pyrene is often utilized in the development of advanced materials such as organic semiconductors, light-emitting diodes (LEDs), and photovoltaic devices. Additionally, its rigid aromatic structure makes it valuable in studying π-conjugated systems and in designing functional materials for sensing and optoelectronic applications.
| Catalog Number | I020766 |
| CAS Number | 34993-56-1 |
| Synonyms | 1-ethynylpyrene |
| Molecular Formula | C18H10 |
| Purity | 98% |
| Target | Cytochrome P450 |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 1-ethynylpyrene |
| InChI | InChI=1S/C18H10/c1-2-12-6-7-15-9-8-13-4-3-5-14-10-11-16(12)18(15)17(13)14/h1,3-11H |
| InChIKey | VEBUBSLYGRMOSZ-UHFFFAOYSA-N |
| SMILES | C#CC1=C2C3=C(C=CC4=C3C(C=C2)=CC=C4)C=C1 |
