For research use only. Not for therapeutic Use.
1-Fluoro-2,4-dimethylbenzene(Cat No.:L006903), is a chemical compound widely used in organic synthesis and as a solvent in various applications. Its molecular structure features a benzene ring with fluorine at the 1st position and methyl groups at the 2nd and 4th positions. This compound is valuable as a building block in the production of pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure allows for diverse chemical transformations, making it useful for the creation of complex organic molecules.
Catalog Number | L006903 |
CAS Number | 452-65-3 |
Molecular Formula | C8H9F |
Purity | ≥95% |
IUPAC Name | 1-fluoro-2,4-dimethylbenzene |
InChI | InChI=1S/C8H9F/c1-6-3-4-8(9)7(2)5-6/h3-5H,1-2H3 |
InChIKey | AAIJEURQKZASKQ-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1)F)C |