1-Fluoro-2,5-dimethyl-4-nitrobenzene (Cat.No:L003601) is a significant compound in organic synthesis. Its distinctive structure, featuring a fluorine-nitro substituted benzene ring, makes it a versatile building block in the preparation of various functional molecules. This compound is employed in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals, showcasing its importance in the production of diverse chemical compounds.
Catalog Number | L003601 |
CAS Number | 1736-88-5 |
Molecular Formula | C8H8FNO2 |
Purity | ≥95% |
IUPAC Name | 1-fluoro-2,5-dimethyl-4-nitrobenzene |
InChI | InChI=1S/C8H8FNO2/c1-5-4-8(10(11)12)6(2)3-7(5)9/h3-4H,1-2H3 |
InChIKey | VUOPPDPBZDVFHW-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1F)C)[N+](=O)[O-] 1-Fluoro-2,5-dimethyl-4-nitrobenzene (CAS 1736-88-5) is a significant compound in organic synthesis. Its distinctive structure, featuring a fluorine-nitro substituted benzene ring, makes it a versatile building block in the preparation of various functional molecules. This compound is employed in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals, showcasing its importance in the production of diverse chemical compounds. |