For research use only. Not for therapeutic Use.
1-Fluoro-3-methoxy-2-methylbenzene(CAT: L026671) is a high-purity aromatic compound widely utilized in pharmaceutical, chemical, and material science research. Featuring a fluorine, methoxy, and methyl substituent on a benzene ring, this compound serves as a versatile intermediate in the synthesis of bioactive molecules, fine chemicals, and advanced materials. Its unique structure makes it particularly valuable in medicinal chemistry for the development of therapeutic agents and for structure-activity relationship studies. With excellent stability and reactivity, 1-Fluoro-3-methoxy-2-methylbenzene ensures precision and reliability, making it an essential tool for advanced research and innovative synthetic applications.
CAS Number | 1159883-21-2 |
Molecular Formula | C8H9FO |
Purity | ≥95% |
IUPAC Name | 1-fluoro-3-methoxy-2-methylbenzene |
InChI | InChI=1S/C8H9FO/c1-6-7(9)4-3-5-8(6)10-2/h3-5H,1-2H3 |
InChIKey | OKQSKCBILCDERK-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC=C1F)OC |