For research use only. Not for therapeutic Use.
1-Fluoro-3-propylbenzene(Cat No.:L006685), is an organic compound consisting of a benzene ring substituted with a fluorine atom and a propyl group. It belongs to the family of fluorobenzenes and alkylbenzenes. Compounds like this are crucial in organic synthesis, serving as building blocks for more complex molecules. Researchers use them in the development of various chemicals, including pharmaceuticals and agrochemicals. The specific arrangement of atoms in 1-fluoro-3-propylbenzene makes it valuable in the creation of specialized materials and the study of structure-activity relationships, contributing significantly to advancements in both industrial applications and scientific research.
CAS Number | 28593-12-6 |
Molecular Formula | C9H11F |
Purity | ≥95% |
IUPAC Name | 1-fluoro-3-propylbenzene |
InChI | InChI=1S/C9H11F/c1-2-4-8-5-3-6-9(10)7-8/h3,5-7H,2,4H2,1H3 |
InChIKey | FBGSJNNMMKJKGE-UHFFFAOYSA-N |
SMILES | CCCC1=CC(=CC=C1)F |