For research use only. Not for therapeutic Use.
1-Fluoro-4-iodo-2-(trifluoromethyl)benzene is an aromatic compound with distinct functional groups, including a fluorine atom, an iodine atom, and a trifluoromethyl group attached to a benzene ring. This combination of halogens and a trifluoromethyl group imparts unique reactivity, making it valuable in synthetic organic chemistry, particularly in coupling reactions. Its electron-withdrawing groups influence both its chemical stability and reactivity, often used in pharmaceuticals, agrochemicals, and material science to introduce fluorinated motifs and halogen functionalities into complex molecules.
| Catalog Number | L016736 |
| CAS Number | 59382-39-7 |
| Molecular Formula | C7H3F4I |
| Purity | ≥95% |
| IUPAC Name | 1-fluoro-4-iodo-2-(trifluoromethyl)benzene |
| InChI | InChI=1S/C7H3F4I/c8-6-2-1-4(12)3-5(6)7(9,10)11/h1-3H |
| InChIKey | DKLKYTATXLQGMX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)C(F)(F)F)F |
