For research use only. Not for therapeutic Use.
1-Fmoc-4-piperidone(Cat No.:L019777), is a chemical compound used in organic synthesis and peptide chemistry. It is a derivative of 4-piperidone with an Fmoc (9-fluorenylmethoxycarbonyl) protecting group attached to the nitrogen atom of the piperidone ring. The Fmoc group is commonly used in solid-phase peptide synthesis to protect the amine group during the coupling of amino acids. This compound is valuable in the construction of peptides and peptidomimetics for various biological and medicinal research purposes.
Catalog Number | L019777 |
CAS Number | 204376-55-6 |
Molecular Formula | C20H19NO3 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 9H-fluoren-9-ylmethyl 4-oxopiperidine-1-carboxylate |
InChI | InChI=1S/C20H19NO3/c22-14-9-11-21(12-10-14)20(23)24-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-8,19H,9-13H2 |
InChIKey | AMWDMRLGMSQZTK-UHFFFAOYSA-N |
SMILES | C1CN(CCC1=O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |