For research use only. Not for therapeutic Use.
1-Hydroxybenzotriazole Hydrate (HOBt Hydrate) is a crucial reagent in peptide synthesis, essential for advanced pharmaceutical and biochemical research. This compound is widely used to enhance coupling efficiency and reduce racemization in peptide bond formation. Its unique properties enable precise and reliable synthesis of peptides and other complex molecules. 1-Hydroxybenzotriazole Hydrate is highly valued for its purity and effectiveness, making it an indispensable tool for researchers developing new drugs, biomolecules, and therapeutic peptides.
CAS Number | 123333-53-9 |
Synonyms | HOBt Hydrate; Benzotriazol-1-ol Hydrate; 1-Hydroxy-1H-benzotriazole Hydrate; 1-Oxy-benztriazol Hydrate; |
Molecular Formula | C6H7N3O2 |
Purity | ≥95% |
Storage | 3 years -20C powder |
IUPAC Name | 1-hydroxybenzotriazole;hydrate |
InChI | InChI=1S/C6H5N3O.H2O/c10-9-6-4-2-1-3-5(6)7-8-9;/h1-4,10H;1H2 |
InChIKey | PJUPKRYGDFTMTM-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)N=NN2O.O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |