For research use only. Not for therapeutic Use.
1-Hydroxyl-1H-pyridine-2-thione(Cat No.:M046431)is a versatile chemical compound commonly used in biochemical and pharmaceutical research. It features a pyridine ring with a hydroxyl group at the 1-position and a thiol group at the 2-position, making it valuable for metal ion coordination and chelation studies. This compound is often utilized in the synthesis of metal complexes and as a reagent for detecting trace metal ions. It also plays a role in antioxidant studies and is considered useful in drug discovery and materials science due to its chemical reactivity and stability.
CAS Number | 1121-30-8 |
Molecular Formula | C5H5NOS |
Purity | ≥95% |
Target | Bacterial |
Storage | Desiccate at -20C |
IUPAC Name | 1-hydroxypyridine-2-thione |
InChI | InChI=1S/C5H5NOS/c7-6-4-2-1-3-5(6)8/h1-4,7H |
InChIKey | YBBJKCMMCRQZMA-UHFFFAOYSA-N |
SMILES | C1=CC(=S)N(C=C1)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |