For research use only. Not for therapeutic Use.
1-Iodo-5-isopropyl-2,4-dimethoxybenzene(CAT: L049081) is a high-purity aromatic compound widely used in pharmaceutical, chemical, and material science research. Featuring a benzene ring with iodine at the 1-position, isopropyl at the 5-position, and methoxy groups at the 2- and 4-positions, this compound offers unique reactivity for advanced organic synthesis. It serves as a valuable intermediate in cross-coupling reactions, such as Suzuki-Miyaura and Heck reactions, enabling the construction of complex molecules. 1-Iodo-5-isopropyl-2,4-dimethoxybenzene supports innovative research in drug discovery, fine chemical production, and the development of advanced materials with consistent performance and reliability.
CAS Number | 1155371-47-3 |
Molecular Formula | C11H15IO2 |
Purity | ≥95% |
IUPAC Name | 1-iodo-2,4-dimethoxy-5-propan-2-ylbenzene |
InChI | InChI=1S/C11H15IO2/c1-7(2)8-5-9(12)11(14-4)6-10(8)13-3/h5-7H,1-4H3 |
InChIKey | QBTLWHYKYLZHKG-UHFFFAOYSA-N |
SMILES | CC(C)C1=CC(=C(C=C1OC)OC)I |