For research use only. Not for therapeutic Use.
1-Isopropyl-3-nitro-1H-pyrazole(CAT: L020800) is a high-purity heterocyclic compound featuring an isopropyl substitution and a nitro group on a pyrazole ring. This compound is widely utilized in pharmaceutical and chemical research as a versatile building block for synthesizing complex organic molecules. Its unique structural properties make it valuable in medicinal chemistry for the development of bioactive compounds and novel therapeutic agents. With consistent quality and stability, 1-Isopropyl-3-nitro-1H-pyrazole supports cutting-edge research in drug discovery, organic synthesis, and material science applications.
CAS Number | 1003012-75-6 |
Molecular Formula | C6H9N3O2 |
Purity | ≥95% |
IUPAC Name | 3-nitro-1-propan-2-ylpyrazole |
InChI | InChI=1S/C6H9N3O2/c1-5(2)8-4-3-6(7-8)9(10)11/h3-5H,1-2H3 |
InChIKey | BVADIEGMRNCQSZ-UHFFFAOYSA-N |
SMILES | CC(C)N1C=CC(=N1)[N+](=O)[O-] |