For research use only. Not for therapeutic Use.
1-Isopropylamino-3-(p-tolyl oxy)-2-propanol (Cat No.:C000801) is a chemical compound characterized by an isopropylamine group attached to a 2-propanol backbone, with a p-tolyl oxy (p-methyl phenyl oxy) substituent. This compound likely holds relevance in medicinal chemistry and drug synthesis. Its unique structure suggests potential interactions with biological systems, making it intriguing for researchers.
| Catalog Number | C000801 |
| CAS Number | 5790-46-5 |
| Synonyms | 1-[(1-Methylethyl)amino]-3-(4-methylphenoxy)-2-propanol |
| Molecular Formula | C₁₃H₂₁NO₂ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated) |
| Appearance | White to Off-White Solid |
| Storage | -20°C, Inert atmosphere |
| IUPAC Name | 1-(4-methylphenoxy)-3-(propan-2-ylamino)propan-2-ol |
| InChI | InChI=1S/C13H21NO2/c1-10(2)14-8-12(15)9-16-13-6-4-11(3)5-7-13/h4-7,10,12,14-15H,8-9H2,1-3H3 |
| InChIKey | MJXGIIVJTPVZCW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OCC(CNC(C)C)O |
| Reference | Tattersfield, A.E., et al.: Brit. J. Clin. Pharmacol., 18, 343 (1984), Kohli, R.S., et al.: Eur. Heart J., 6, 845 (1985), Zachariah, P.K., et al.: Clin. Ther., 15, 779 (1993), |
