For research use only. Not for therapeutic Use.
1-(Isopropylsulfonyl)-2-nitrobenzene is an aromatic compound with an isopropylsulfonyl group attached to the benzene ring at the 1-position and a nitro group at the 2-position. The combination of electron-withdrawing groups (sulfonyl and nitro) enhances the ring’s electrophilic properties, making it a valuable intermediate in organic synthesis. Frequently used in pharmaceutical and agrochemical research, this compound can serve as a building block for more complex molecules, especially in reactions requiring electron-deficient aromatic systems for further functionalization.
| Catalog Number | L027339 |
| CAS Number | 70415-86-0 |
| Molecular Formula | C9H11NO4S |
| Purity | ≥95% |
| IUPAC Name | 1-nitro-2-propan-2-ylsulfonylbenzene |
| InChI | InChI=1S/C9H11NO4S/c1-7(2)15(13,14)9-6-4-3-5-8(9)10(11)12/h3-7H,1-2H3 |
| InChIKey | GBFWDLQEEMHXME-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)C1=CC=CC=C1[N+](=O)[O-] |
