For research use only. Not for therapeutic Use.
1-(Isothiocyanatomethyl)-3-(trifluoromethyl)benzene(Cat No.:L007226), is a chemical compound with the molecular formula C9H6F3NS. It features a benzene ring substituted with an isothiocyanatomethyl group at the 1st position and a trifluoromethyl group at the 3rd position. This compound is important in organic synthesis and medicinal chemistry research. Its unique structure makes it valuable for designing molecules with potential biological activities. Researchers utilize 1-(Isothiocyanatomethyl)-3-(trifluoromethyl)benzene as a key intermediate, facilitating the creation of diverse organic compounds, and contributing to advancements in drug discovery and the development of potential therapeutic agents.
CAS Number | 2740-85-4 |
Molecular Formula | C9H6F3NS |
Purity | ≥95% |
IUPAC Name | 1-(isothiocyanatomethyl)-3-(trifluoromethyl)benzene |
InChI | InChI=1S/C9H6F3NS/c10-9(11,12)8-3-1-2-7(4-8)5-13-6-14/h1-4H,5H2 |
InChIKey | ROXHCSQEJLPTSB-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)C(F)(F)F)CN=C=S |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |