For research use only. Not for therapeutic Use.
1-Kestose(Cat No.:R031281) is a fructooligosaccharide (FOS) component known for its ability to effectively stimulate the growth of beneficial bacteria such as Faecalibacterium prausnitzii and Bifidobacteria. As the smallest FOS component, 1-Kestose serves as a prebiotic, providing nourishment to these beneficial gut bacteria. The stimulation of Faecalibacterium prausnitzii and Bifidobacteria by 1-Kestose contributes to the maintenance of a healthy gut microbiota, which is associated with various health benefits including improved digestion, immune function, and overall well-being.
CAS Number | 470-69-9 |
Synonyms | O-β-D-Fructofuranosyl-(2→1)-β-D-fructofuranosyl α-D-Glucopyranoside; 1-Kestotriose; 1F-Fructosylsucrose; 1-Fructosylsucrose; GF 2 |
Molecular Formula | C18H32O16 |
Purity | ≥95% |
Target | Anti-infection |
Storage | 2-8°C |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-2-[[(2R,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
InChI | InChI=1S/C18H32O16/c19-1-6-9(23)12(26)13(27)16(31-6)34-18(15(29)11(25)8(3-21)33-18)5-30-17(4-22)14(28)10(24)7(2-20)32-17/h6-16,19-29H,1-5H2/t6-,7-,8-,9-,10-,11-,12+,13-,14+,15+,16-,17-,18+/m1/s1 |
InChIKey | VAWYEUIPHLMNNF-OESPXIITSA-N |
SMILES | C(C1C(C(C(C(O1)OC2(C(C(C(O2)CO)O)O)COC3(C(C(C(O3)CO)O)O)CO)O)O)O)O |