For research use only. Not for therapeutic Use.
1-Linoleoyl-rac-glycerol is a monoacylglycerol, consisting of a single linoleic acid molecule (an omega-6 polyunsaturated fatty acid) esterified to the first position of glycerol. This compound serves as an intermediate in lipid metabolism and is involved in various biological processes, including energy storage, cell signaling, and lipid digestion. Monoacylglycerols like 1-linoleoyl-rac-glycerol are also of interest in food and pharmaceutical industries due to their emulsifying properties. Additionally, linoleic acid, a key component, plays an important role in maintaining cell membrane integrity and supporting skin health, making its derivatives valuable in skin care and nutritional products.
CAS Number | 2277-28-3 |
Synonyms | (9Z,12Z)-9,12-Octadecadienoic Acid 2,3-Dihydroxypropyl Ester; 1-Glyceryl Linoleate; 1-Linoleylglycerol; 1-Monolinolein; 1-Monolinoleoyl-rac-glycerol; Glycerol 1-Monolinolate; Oleinate 288; α-Glyceryl linoleate; α-Monolinolein; ? |
Molecular Formula | C21H38O4 |
Purity | ≥95% |
Target | Phospholipase |
Storage | -80°C |
InChI | InChI=1S/C21H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h6-7,9-10,20,22-23H,2-5,8,11-19H2,1H3/b7-6-,10-9- |
InChIKey | WECGLUPZRHILCT-HZJYTTRNSA-N |
SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(CO)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |