For research use only. Not for therapeutic Use.
(1-mercaptoundec-11-yl)Hexa (ethylene glycol) （Cat No.:M118182）is a compound with a mercaptan (thiol) group at one end and a hexamethylene glycol chain at the other. This molecule is used in various applications, including as a surface modifier for nanoparticles and in the synthesis of functional materials. The thiol group allows it to bind to surfaces or other molecules, while the ethylene glycol chain provides solubility and flexibility. This compound is particularly useful in nanotechnology for modifying the surface properties of nanoparticles, which can affect their stability, dispersibility, and interactions with other molecules.
| Catalog Number | M118182 |
| CAS Number | 130727-44-5 |
| Molecular Formula | C23H48O7S |
| Purity | ≥95% |
| Target | PROTAC Linkers |
| Storage | Store at RT |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(11-sulfanylundecoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChI | InChI=1S/C23H48O7S/c24-10-12-26-14-16-28-18-20-30-22-21-29-19-17-27-15-13-25-11-8-6-4-2-1-3-5-7-9-23-31/h24,31H,1-23H2 |
| InChIKey | QYKSUHRPPSCIFK-UHFFFAOYSA-N |
| SMILES | C(CCCCCOCCOCCOCCOCCOCCOCCO)CCCCCS |
