For research use only. Not for therapeutic Use.
1-Methoxy-3-vinylbenzene(Cat No.:L006713), is a chemical compound featuring a phenyl ring substituted with a methoxy group at the 1st position and a vinyl group at the 3rd position. This compound is crucial in organic synthesis, serving as a valuable starting material for the creation of various specialized chemicals. Its versatile reactivity makes it useful in the preparation of pharmaceuticals, agrochemicals, and fine chemicals. Researchers leverage its specific structure for diverse chemical transformations, contributing significantly to the synthesis of complex organic molecules and advancements in drug discovery, materials science, and other industrial applications.
CAS Number | 626-20-0 |
Molecular Formula | C9H10O |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1-ethenyl-3-methoxybenzene |
InChI | InChI=1S/C9H10O/c1-3-8-5-4-6-9(7-8)10-2/h3-7H,1H2,2H3 |
InChIKey | PECUPOXPPBBFLU-UHFFFAOYSA-N |
SMILES | COC1=CC=CC(=C1)C=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |