For research use only. Not for therapeutic Use.
1-Methoxy-4-(methylthio)benzene (Cat.No:M119762) is a chemical compound commonly used as a building block in organic synthesis. Its structure contains a methoxy group and a methylthio group attached to a benzene ring. This compound serves as a valuable intermediate in the production of various chemicals, including pharmaceuticals and fragrances.
CAS Number | 1879-16-9 |
Molecular Formula | C8H10OS |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-methoxy-4-methylsulfanylbenzene |
InChI | InChI=1S/C8H10OS/c1-9-7-3-5-8(10-2)6-4-7/h3-6H,1-2H3 |
InChIKey | DQNSKXYRRRCKGH-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)SC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |