For research use only. Not for therapeutic Use.
1-Methoxypentane-2,4-dione(Cat No.:L019440)is a versatile compound used in organic synthesis, particularly in pharmaceutical and chemical research. Featuring both methoxy and diketone functional groups, it offers significant reactivity for constructing complex molecules. This compound serves as an important intermediate in the development of bioactive substances, enabling the synthesis of heterocyclic compounds, potential drug candidates, and fine chemicals. Its structure allows for various chemical transformations, making it a valuable tool in medicinal chemistry, agrochemical production, and material science for creating novel compounds with diverse applications.
CAS Number | 6290-50-2 |
Molecular Formula | C6H10O3 |
Purity | ≥95% |
IUPAC Name | 1-methoxypentane-2,4-dione |
InChI | InChI=1S/C6H10O3/c1-5(7)3-6(8)4-9-2/h3-4H2,1-2H3 |
InChIKey | RZCMFVQMQKCVEN-UHFFFAOYSA-N |
SMILES | CC(=O)CC(=O)COC |