For research use only. Not for therapeutic Use.
(1-Methyl-1h-benzimidazol-2-yl)methylamine (CAT: L000230) is a valuable compound used in pharmaceutical and organic chemistry. It acts as a key building block for the synthesis of various organic molecules and pharmaceutical agents. In pharmaceutical research, this compound is employed to introduce the benzimidazole moiety into drug candidates, influencing their biological activity. In organic chemistry, it is an essential reagent for the creation of complex organic structures.
CAS Number | 20028-40-4 |
Molecular Formula | C9H11N3 |
Purity | ≥95% |
IUPAC Name | (1-methylbenzimidazol-2-yl)methanamine |
InChI | InChI=1S/C9H11N3/c1-12-8-5-3-2-4-7(8)11-9(12)6-10/h2-5H,6,10H2,1H3 |
InChIKey | GFQZSGGPNZDNBC-UHFFFAOYSA-N |