For research use only. Not for therapeutic Use.
1-Methyl-1H-pyrazol-4-ol is a methylated pyrazole derivative with a hydroxyl group, commonly utilized in pharmaceutical and chemical research. This compound’s structure, featuring both a methyl and hydroxyl group on a pyrazole ring, enhances its reactivity, making it a valuable intermediate in synthesizing bioactive molecules. It is particularly useful in the development of enzyme inhibitors and compounds targeting neurological pathways. Its stability and versatility support diverse applications in medicinal chemistry, organic synthesis, and studies focused on heterocyclic compounds.
Catalog Number | L035326 |
CAS Number | 78242-20-3 |
Molecular Formula | C4H6N2O |
Purity | ≥95% |
IUPAC Name | 1-methylpyrazol-4-ol |
InChI | InChI=1S/C4H6N2O/c1-6-3-4(7)2-5-6/h2-3,7H,1H3 |
InChIKey | FQASUNMXKLPOOF-UHFFFAOYSA-N |
SMILES | CN1C=C(C=N1)O |