For research use only. Not for therapeutic Use.
1-Methyl-1H-pyrazolo[3,4-c]pyridin-4-amine(CAT: L000394) is a compound with potential applications in organic chemistry. Its structure, containing a pyrazolo-pyridine core, makes it a valuable intermediate for the synthesis of various organic molecules. In organic chemistry, it can serve as a building block for creating compounds with specific functionalities or as an intermediate in the production of specialty chemicals.
CAS Number | 2172072-40-9 |
Molecular Formula | C7H8N4 |
Purity | ≥95% |
IUPAC Name | 1-methylpyrazolo[3,4-c]pyridin-4-amine |
InChI | InChI=1S/C7H8N4/c1-11-7-4-9-3-6(8)5(7)2-10-11/h2-4H,8H2,1H3 |
InChIKey | NMSMRFVMMYGZOZ-UHFFFAOYSA-N |