For research use only. Not for therapeutic Use.
1-Methyl-2-(methylthio)imidazole (Cat No.:R041601) is a chemical compound. It consists of an imidazole ring substituted with a methyl group and a methylthio (CH3S) group. This compound holds importance in both organic synthesis and biochemistry. Its imidazole moiety is a key structural element found in various biologically active molecules. 1-Methyl-2-(methylthio)imidazole could participate in diverse chemical reactions due to its unique substitution pattern, potentially yielding compounds with specific functions. Its presence in natural compounds and its reactivity contribute to its role in creating molecules for research and potential therapeutic applications.
CAS Number | 14486-52-3 |
Synonyms | 1-Methyl-2-(methylthio)imidazole; 2-Methylthio-3-methylimidazole |
Molecular Formula | C5H8N2S |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 1-methyl-2-methylsulfanylimidazole |
InChI | InChI=1S/C5H8N2S/c1-7-4-3-6-5(7)8-2/h3-4H,1-2H3 |
InChIKey | LKIVEIAXFZBGMO-UHFFFAOYSA-N |
SMILES | CN1C=CN=C1SC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |