For research use only. Not for therapeutic Use.
(1-Methyl-2-oxoindolin-6-yl)boronic acid (Cat.No:(Cat.No:I014009)) is a pivotal chemical compound in medicinal chemistry. Its unique structure, incorporating both an indolinone and boronic acid moiety, offers versatility in drug design. This compound is crucial in the development of pharmaceutical agents, particularly in the realm of proteasome inhibitors.
CAS Number | 1260433-35-9 |
Molecular Formula | C9H10BNO3 |
Purity | ≥95% |
IUPAC Name | (1-methyl-2-oxo-3H-indol-6-yl)boronic acid |
InChI | InChI=1S/C9H10BNO3/c1-11-8-5-7(10(13)14)3-2-6(8)4-9(11)12/h2-3,5,13-14H,4H2,1H3 |
InChIKey | RXZAMZIQYGRSKS-UHFFFAOYSA-N |
SMILES | B(C1=CC2=C(CC(=O)N2C)C=C1)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |