For research use only. Not for therapeutic Use.
1-Methyl-2-vinyl-1H-pyrrole(Cat No.:L007416), is a chemical compound with the molecular formula C7H9N. It is a pyrrole derivative containing a methyl group and a vinyl group. Pyrroles are important heterocyclic compounds that find various applications in organic synthesis and medicinal chemistry. This specific compound, with its unique combination of functional groups, likely holds significance in the development of pharmaceuticals, agrochemicals, or materials with specific properties.
CAS Number | 2540-06-9 |
Molecular Formula | C7H9N |
Purity | ≥95% |
IUPAC Name | 2-ethenyl-1-methylpyrrole |
InChI | InChI=1S/C7H9N/c1-3-7-5-4-6-8(7)2/h3-6H,1H2,2H3 |
InChIKey | GHGVPCNHGZIJRN-UHFFFAOYSA-N |
SMILES | CN1C=CC=C1C=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |