For research use only. Not for therapeutic Use.
1-Methyl-2,3-dihydro-1H-inden-1-ol(CAT: L024679) is a high-purity cyclic alcohol compound widely utilized in pharmaceutical, chemical, and material science research. Featuring an indane core with a methyl and hydroxyl group, this compound serves as a versatile intermediate in the synthesis of bioactive molecules, fine chemicals, and advanced materials. Its unique structure makes it valuable in medicinal chemistry for the development of therapeutic agents and structure-activity relationship studies. With excellent stability and reactivity, 1-Methyl-2,3-dihydro-1H-inden-1-ol ensures precision and reliability, making it an essential tool for innovative research and advanced synthetic applications.
CAS Number | 64666-42-8 |
Molecular Formula | C10H12O |
Purity | ≥95% |
IUPAC Name | 1-methyl-2,3-dihydroinden-1-ol |
InChI | InChI=1S/C10H12O/c1-10(11)7-6-8-4-2-3-5-9(8)10/h2-5,11H,6-7H2,1H3 |
InChIKey | ARYNNMVDWALCPX-UHFFFAOYSA-N |
SMILES | CC1(CCC2=CC=CC=C21)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |