For research use only. Not for therapeutic Use.
1-Methyl-3-propylimidazolium bromide(Cat No.:L010702)is a high-purity ionic liquid commonly used in chemical research and industrial applications. This compound features an imidazolium core with a methyl group at the 1-position and a propyl group at the 3-position, paired with a bromide anion. Its ionic nature imparts unique properties, such as low volatility, high thermal stability, and the ability to dissolve a wide range of substances. 1-Methyl-3-propylimidazolium bromide is essential for applications in green chemistry, catalysis, and electrochemical processes, contributing to advancements in sustainable technologies and innovative research.
CAS Number | 85100-76-1 |
Molecular Formula | C7H13BrN2 |
Purity | ≥95% |
IUPAC Name | 1-methyl-3-propyl-2H-imidazole;hydrobromide |
InChI | InChI=1S/C7H14N2.BrH/c1-3-4-9-6-5-8(2)7-9;/h5-6H,3-4,7H2,1-2H3;1H |
InChIKey | LXKJXSIVSWFKQA-UHFFFAOYSA-N |
SMILES | CCCN1CN(C=C1)C.Br |