Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide
For research use only. Not for therapeutic Use.
1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide(Cat No.:L023423)is a specialized organic compound commonly used in pharmaceutical and agrochemical research. Featuring a trifluoromethyl group and a carboxamide functional group attached to a methylated pyrazole ring, this compound serves as a key intermediate in the synthesis of complex molecules. Its unique structure allows for targeted chemical modifications, making it valuable in the development of new therapeutic agents and crop protection chemicals. 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide is essential for high-precision synthesis and innovative research in medicinal chemistry.
CAS Number | 937717-66-3 |
Molecular Formula | C6H6F3N3O |
Purity | ≥95% |
IUPAC Name | 1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
InChI | InChI=1S/C6H6F3N3O/c1-12-2-3(5(10)13)4(11-12)6(7,8)9/h2H,1H3,(H2,10,13) |
InChIKey | UTBJLKDVQNCKAS-UHFFFAOYSA-N |
SMILES | CN1C=C(C(=N1)C(F)(F)F)C(=O)N |