For research use only. Not for therapeutic Use.
1-Methyl-4-nitro-1H-pyrazole-3-carboxamide is an organic compound featuring a pyrazole ring substituted with a methyl group at the first position, a nitro group (-NO₂) at the fourth position, and a carboxamide group (-CONH₂) at the third position. Its chemical formula is C₆H₈N₄O₃. This compound is of interest in medicinal chemistry due to its potential pharmacological activities, including antitumor and antimicrobial properties. The presence of diverse functional groups allows for various chemical transformations, enhancing its utility in drug design.
CAS Number | 3920-39-6 |
Molecular Formula | C5H6N4O3 |
Purity | ≥95% |
IUPAC Name | 1-methyl-4-nitropyrazole-3-carboxamide |
InChI | InChI=1S/C5H6N4O3/c1-8-2-3(9(11)12)4(7-8)5(6)10/h2H,1H3,(H2,6,10) |
InChIKey | YVMXSLMGSDQURV-UHFFFAOYSA-N |
SMILES | CN1C=C(C(=N1)C(=O)N)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |