For research use only. Not for therapeutic Use.
1-Methyl-4-oxocyclohexanecarboxylic acid is a cyclic carboxylic acid characterized by a methyl group at the first position and a keto group at the fourth position of the cyclohexane ring. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various organic transformations. It serves as an important intermediate in synthetic chemistry, particularly in the synthesis of pharmaceuticals and agrochemicals. Its unique structure may impart specific properties beneficial for drug development and material science applications.
CAS Number | 24463-41-0 |
Molecular Formula | C8H12O3 |
Purity | ≥95% |
IUPAC Name | 1-methyl-4-oxocyclohexane-1-carboxylic acid |
InChI | InChI=1S/C8H12O3/c1-8(7(10)11)4-2-6(9)3-5-8/h2-5H2,1H3,(H,10,11) |
InChIKey | YRFRXDSPVDAITF-UHFFFAOYSA-N |
SMILES | CC1(CCC(=O)CC1)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |