For research use only. Not for therapeutic Use.
1-Methyl-4-(phenylmethyl)piperazine is a chemical compound featuring a piperazine ring substituted with a methyl group and a phenylmethyl group. It is utilized in medicinal chemistry as an intermediate in synthesizing pharmaceuticals and psychoactive substances. Its structural properties allow for modifications that can yield a variety of biologically active molecules. This compound plays a crucial role in drug development, helping researchers design and produce new therapeutic agents targeting various medical conditions.
CAS Number | 62226-74-8 |
Synonyms | 1-Benzyl-4-methylpiperazine |
Molecular Formula | C12H18N2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-benzyl-4-methylpiperazine |
InChI | InChI=1S/C12H18N2/c1-13-7-9-14(10-8-13)11-12-5-3-2-4-6-12/h2-6H,7-11H2,1H3 |
InChIKey | MLJOKPBESJWYGL-UHFFFAOYSA-N |
SMILES | CN1CCN(CC1)CC2=CC=CC=C2 |