Home
>
Reference Standards>Cell Cycle>Heterocyclic Building Blocks> 1-Methyl-5-oxo-D-proline methyl ester
For research use only. Not for therapeutic Use.
1-Methyl-5-oxo-D-proline methyl ester(Cat No.:M015942)is a synthetic compound that serves as an important intermediate in organic synthesis, particularly in the development of bioactive molecules. This compound features a proline derivative structure, which is essential in medicinal chemistry for designing peptide mimetics and pharmaceuticals. Its unique functional groups allow for various chemical modifications, facilitating the exploration of structure-activity relationships. Research indicates that derivatives of 1-methyl-5-oxo-D-proline methyl ester may exhibit biological activities, making it a valuable candidate for further studies in drug development and therapeutic applications.
Catalog Number | M015942 |
CAS Number | 122742-14-7 |
Molecular Formula | C7H11NO3 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | methyl (2R)-1-methyl-5-oxopyrrolidine-2-carboxylate |
InChI | InChI=1S/C7H11NO3/c1-8-5(7(10)11-2)3-4-6(8)9/h5H,3-4H2,1-2H3/t5-/m1/s1 |
InChIKey | ABAOXDQXQHQRFA-RXMQYKEDSA-N |
SMILES | CN1[C@H](CCC1=O)C(=O)OC |