Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-methyl-5-(propan-2-yl)-1H-pyrazole-3-carboxylic acid
For research use only. Not for therapeutic Use.
1-methyl-5-(propane-2-yl)-1H-pyrazole-3-carboxylic acid(Cat No.:L007289), is an organic compound featuring a pyrazole ring substituted with a methyl group at position 1 and a carboxylic acid group at position 3. The presence of a propan-2-yl (isopropyl) group at position 5 adds complexity to its structure. Compounds containing pyrazole rings are significant in medicinal chemistry and drug development due to their diverse biological activities, including anti-inflammatory, antimicrobial, and antiviral properties. Researchers often modify pyrazole derivatives to explore their potential as therapeutic agents, making this compound valuable in pharmaceutical research and synthesis endeavors.
Catalog Number | L007289 |
CAS Number | 1052668-36-6 |
Molecular Formula | C8H12N2O2 |
Purity | ≥95% |
IUPAC Name | 1-methyl-5-propan-2-ylpyrazole-3-carboxylic acid |
InChI | InChI=1S/C8H12N2O2/c1-5(2)7-4-6(8(11)12)9-10(7)3/h4-5H,1-3H3,(H,11,12) |
InChIKey | WGUJIFSGTIEUPS-UHFFFAOYSA-N |
SMILES | CC(C)C1=CC(=NN1C)C(=O)O |