For research use only. Not for therapeutic Use.
1-Methyl-6,7-dihydro-1H-indazol-5(4H)-one is a heterocyclic compound characterized by a methyl group and a saturated indazole structure. This compound is significant in medicinal chemistry due to its potential biological activities, including anti-inflammatory and neuroprotective effects. The unique indazole framework allows for diverse modifications, enhancing its reactivity and solubility. Its structure makes it a valuable scaffold for the development of novel therapeutic agents and in exploring new applications in drug discovery, particularly in treating neurological disorders and other diseases.
CAS Number | 115215-92-4 |
Molecular Formula | C8H10N2O |
Purity | ≥95% |
IUPAC Name | 1-methyl-6,7-dihydro-4H-indazol-5-one |
InChI | InChI=1S/C8H10N2O/c1-10-8-3-2-7(11)4-6(8)5-9-10/h5H,2-4H2,1H3 |
InChIKey | MROQHXYFRGTYHP-UHFFFAOYSA-N |
SMILES | CN1C2=C(CC(=O)CC2)C=N1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |