For research use only. Not for therapeutic Use.
1-Methyl-Inosine is a modified nucleoside used in biochemical and pharmaceutical research. It is essential for studying RNA modifications, nucleic acid interactions, and enzymatic processes. This compound aids in understanding molecular mechanisms and developing therapeutic agents, ensuring precise and reliable results in advanced nucleic acid and metabolic research.
| Catalog Number | R015954 |
| CAS Number | 2140-73-0 |
| Synonyms | 1-Methylinosine; N1-Methylinosine; |
| Molecular Formula | C11H14N4O5 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | Store at -20°C |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpurin-6-one |
| InChI | InChI=1S/C11H14N4O5/c1-14-3-13-9-6(10(14)19)12-4-15(9)11-8(18)7(17)5(2-16)20-11/h3-5,7-8,11,16-18H,2H2,1H3/t5-,7-,8-,11-/m1/s1 |
| InChIKey | WJNGQIYEQLPJMN-IOSLPCCCSA-N |
| SMILES | CN1C=NC2=C(C1=O)N=CN2C3C(C(C(O3)CO)O)O |
