For research use only. Not for therapeutic Use.
1-Methylindene(CAT: R068992) is a compound of significance in the realm of organic chemistry. It is an aromatic hydrocarbon with a substituted methyl group. Indene compounds like 1-Methylindene have diverse applications, including use as intermediates in the synthesis of various organic compounds. Their structural features make them valuable in the creation of specialized molecules with specific properties.
| Catalog Number | R068992 |
| CAS Number | 767-59-9 |
| Molecular Formula | C10H10 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 1-methyl-1H-indene |
| InChI | InChI=1S/C10H10/c1-8-6-7-9-4-2-3-5-10(8)9/h2-8H,1H3 |
| InChIKey | LRTOHSLOFCWHRF-UHFFFAOYSA-N |
| SMILES | CC1C=CC2=CC=CC=C12 |
