For research use only. Not for therapeutic Use.
1-Methylindene(CAT: R068992) is a compound of significance in the realm of organic chemistry. It is an aromatic hydrocarbon with a substituted methyl group. Indene compounds like 1-Methylindene have diverse applications, including use as intermediates in the synthesis of various organic compounds. Their structural features make them valuable in the creation of specialized molecules with specific properties.
CAS Number | 767-59-9 |
Molecular Formula | C10H10 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 1-methyl-1H-indene |
InChI | InChI=1S/C10H10/c1-8-6-7-9-4-2-3-5-10(8)9/h2-8H,1H3 |
InChIKey | LRTOHSLOFCWHRF-UHFFFAOYSA-N |
SMILES | CC1C=CC2=CC=CC=C12 |