For research use only. Not for therapeutic Use.
1-Methylisoquinoline-3-carbaldehyde(CAT: L032727) is a high-purity heterocyclic compound featuring a methyl-substituted isoquinoline core with an aldehyde functional group. This versatile molecule is widely used in pharmaceutical and chemical research, particularly as a key intermediate in the synthesis of complex organic compounds and bioactive molecules. Its unique structure makes it valuable for medicinal chemistry applications, including the development of novel therapeutic agents. With reliable quality and excellent stability, 1-Methylisoquinoline-3-carbaldehyde supports advanced research in drug discovery, organic synthesis, and material science.
CAS Number | 1500249-21-7 |
Molecular Formula | C11H9NO |
Purity | ≥95% |
IUPAC Name | 1-methylisoquinoline-3-carbaldehyde |
InChI | InChI=1S/C11H9NO/c1-8-11-5-3-2-4-9(11)6-10(7-13)12-8/h2-7H,1H3 |
InChIKey | NJBZZTHJHMDSKK-UHFFFAOYSA-N |
SMILES | CC1=NC(=CC2=CC=CC=C12)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |