Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 1-Methylpiperidine-2,6-dione
For research use only. Not for therapeutic Use.
1-Methylpiperidine-2,6-dione (Cat No.:L029217) is a chemical compound featuring a piperidine ring substituted by a methyl group at the 1-position and two carbonyl (C=O) groups at the 2- and 6-positions. It is also known as 2,6-piperidinedione, 1-methyl. This compound serves as a valuable building block or intermediate in organic synthesis and pharmaceutical research. Its unique structure makes it potentially useful for creating diverse molecules with potential applications in drug development or other chemical processes.
CAS Number | 25077-25-2 |
Molecular Formula | C6H9NO2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 1-methylpiperidine-2,6-dione |
InChI | InChI=1S/C6H9NO2/c1-7-5(8)3-2-4-6(7)9/h2-4H2,1H3 |
InChIKey | VUYOLIKWIVQHBC-UHFFFAOYSA-N |
SMILES | CN1C(=O)CCCC1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |