Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 1-Methylpiperidine-4-carbonitrile
For research use only. Not for therapeutic Use.
1-Methylpiperidine-4-carbonitrile(Cat No.:L011859), is a chemical compound used in organic synthesis and pharmaceutical research. It is a piperidine derivative containing a methyl group and a carbonitrile group attached to the piperidine ring at different positions. This compound serves as a valuable intermediate in the synthesis of various organic molecules and pharmaceutical compounds. Its unique structure and reactivity make it useful for introducing specific functional groups into target molecules.
CAS Number | 20691-92-3 |
Molecular Formula | C7H12N2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1-methylpiperidine-4-carbonitrile |
InChI | InChI=1S/C7H12N2/c1-9-4-2-7(6-8)3-5-9/h7H,2-5H2,1H3 |
InChIKey | HNAKTMSXYZOSTP-UHFFFAOYSA-N |
SMILES | CN1CCC(CC1)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |