For research use only. Not for therapeutic Use.
1-Methylpseudouridine is a modified nucleoside derived from uridine, where the methyl group is attached to the nitrogen at the 1-position of pseudouridine. This modification enhances the stability and translational efficiency of mRNA, making it particularly valuable in the development of mRNA-based therapeutics and vaccines. 1-Methylpseudouridine reduces the immunogenicity of synthetic mRNA, allowing for more efficient protein production in cells. It is a key component in the advancement of mRNA technology, contributing to the success of modern mRNA vaccines and therapies.
CAS Number | 13860-38-3 |
Synonyms | m(1)f; |
Molecular Formula | C10H14N2O6 |
Purity | ≥95% |
Target | Nucleoside Antimetabolite/Analog |
Storage | -20°C |
IUPAC Name | 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpyrimidine-2,4-dione |
InChI | InChI=1S/C10H14N2O6/c1-12-2-4(9(16)11-10(12)17)8-7(15)6(14)5(3-13)18-8/h2,5-8,13-15H,3H2,1H3,(H,11,16,17)/t5-,6-,7-,8+/m1/s1 |
InChIKey | UVBYMVOUBXYSFV-XUTVFYLZSA-N |
SMILES | CN1C=C(C(=O)NC1=O)C2C(C(C(O2)CO)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |