Home
>
Chemical Reagents>Organic Building Blocks> 1-(Methylsulfonyl)-4-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperidine
For research use only. Not for therapeutic Use.
1-(Methylsulfonyl)-4-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperidine(Cat No.:L033215)is a complex organic compound used in pharmaceutical and chemical research. This molecule combines a piperidine ring with a methylsulfonyl group and a phenyl ring bearing a dioxaborolane moiety. It serves as a key intermediate in the synthesis of bioactive molecules, particularly in cross-coupling reactions like Suzuki-Miyaura, which are pivotal in creating complex molecular architectures. Its unique structure and reactivity make it valuable for developing novel therapeutic agents and materials in medicinal chemistry.
CAS Number | 1428329-80-9 |
Molecular Formula | C18H28BNO4S |
Purity | ≥95% |
IUPAC Name | 1-methylsulfonyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine |
InChI | InChI=1S/C18H28BNO4S/c1-17(2)18(3,4)24-19(23-17)16-8-6-14(7-9-16)15-10-12-20(13-11-15)25(5,21)22/h6-9,15H,10-13H2,1-5H3 |
InChIKey | DTGDCKYWMHHVHA-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3CCN(CC3)S(=O)(=O)C |