For research use only. Not for therapeutic Use.
1-N-Boc-3-Azetidinecarboxylic acid(CAT: M094875) is a chemical compound used in organic synthesis and as a building block in pharmaceutical research. Its mode of action involves being a derivative of 3-azetidinecarboxylic acid, where the nitrogen atom is protected with a tert-butyloxycarbonyl (Boc) group. This Boc protection provides stability to the molecule during various chemical reactions. Researchers use 1-N-Boc-3-Azetidinecarboxylic acid in the synthesis of complex organic compounds and peptides due to its unique chemical properties. It is particularly valuable in medicinal chemistry studies, drug development, and the preparation of potential drug candidates.
CAS Number | 142253-55-2 |
Molecular Formula | C9H15NO4 |
Purity | ≥95% |
Target | PROTAC |
Storage | Store at -20C |
IUPAC Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid |
InChI | InChI=1S/C9H15NO4/c1-9(2,3)14-8(13)10-4-6(5-10)7(11)12/h6H,4-5H2,1-3H3,(H,11,12) |
InChIKey | NCADHSLPNSTDMJ-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CC(C1)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |