For research use only. Not for therapeutic Use.
1-N-Boc-3-Fluoroaniline(CAT: L019325) is a high-purity compound widely employed in pharmaceutical and synthetic chemistry research. This fluorinated aniline derivative features a tert-butyloxycarbonyl (Boc) protecting group, making it an ideal intermediate for the synthesis of complex organic molecules and bioactive compounds. Its unique structure facilitates applications in drug discovery, medicinal chemistry, and the development of advanced materials. With excellent stability and reactivity, 1-N-Boc-3-Fluoroaniline is a valuable building block for researchers pursuing innovative solutions in molecular design and therapeutic agent development.
CAS Number | 81740-18-3 |
Molecular Formula | C11H14FNO2 |
Purity | ≥95% |
IUPAC Name | tert-butyl N-(3-fluorophenyl)carbamate |
InChI | InChI=1S/C11H14FNO2/c1-11(2,3)15-10(14)13-9-6-4-5-8(12)7-9/h4-7H,1-3H3,(H,13,14) |
InChIKey | ZTELOKGOCXECBW-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NC1=CC(=CC=C1)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |