For research use only. Not for therapeutic Use.
1-n-Butylnaphthalene（Cat No.:M121119） is an organic compound composed of a naphthalene ring with a butyl group attached at the first position. It is a colorless to pale yellow liquid with a molecular formula C14H16. 1-n-Butylnaphthalene is primarily used as a solvent in various industrial applications, including the production of coatings, paints, and asphalt. It is valued for its high solvency power and compatibility with a wide range of materials. Additionally, 1-n-butyl naphthalene is used as a chemical intermediate in the synthesis of other compounds.
| Catalog Number | M121119 |
| CAS Number | 1634-09-9 |
| Synonyms | 1-n-Butylnaphthalene |
| Molecular Formula | C14H16 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-butylnaphthalene |
| InChI | InChI=1S/C14H16/c1-2-3-7-12-9-6-10-13-8-4-5-11-14(12)13/h4-6,8-11H,2-3,7H2,1H3 |
| InChIKey | URGSMJLDEFDWNX-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=CC2=CC=CC=C21 |
