Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-(Naphthalen-1-yl)pentan-1-amine hydrochloride
For research use only. Not for therapeutic Use.
1-(Naphthalen-1-yl)pentan-1-amine hydrochloride(Cat No.:L007882), with the chemical formula C15H20ClN. This compound features a naphthalene-1-yl group attached to a pentylamine backbone, with the hydrochloride salt form enhancing its solubility and stability. Compounds like these find applications in chemical research and organic synthesis, often used as intermediates in the creation of complex organic molecules. The unique structure of this compound makes it valuable in the design and development of specialized chemicals and potential drug candidates. Researchers explore its properties to create diverse molecules for applications in medicinal chemistry and related scientific fields.
CAS Number | 39110-83-3 |
Molecular Formula | C15H20ClN |
Purity | ≥95% |
IUPAC Name | 1-naphthalen-1-ylpentan-1-amine;hydrochloride |
InChI | InChI=1S/C15H19N.ClH/c1-2-3-11-15(16)14-10-6-8-12-7-4-5-9-13(12)14;/h4-10,15H,2-3,11,16H2,1H3;1H |
InChIKey | SQOKMTLKEVYJJX-UHFFFAOYSA-N |
SMILES | CCCCC(C1=CC=CC2=CC=CC=C21)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |