For research use only. Not for therapeutic Use.
1-Naphthoic acid is used as an intermediate for the synthesis of various compounds.
Catalog Number | R019625 |
CAS Number | 86-55-5 |
Synonyms | 1-Naphthoic Acid; 1-Carboxynaphthalene; 1-Naphthylcarboxylic Acid; 1-Napthanoic Acid; NSC 37569; Naphthalene-α-carboxylic Acid; α-Naphthoic Acid; α-Naphthylcarboxylic Acid |
Molecular Formula | C11H8O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | naphthalene-1-carboxylic acid |
InChI | InChI=1S/C11H8O2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H,12,13) |
InChIKey | LNETULKMXZVUST-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)O |